C12H25Cl2N3O — CID 119888242
2-amino-2-methyl-1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propan-1-one;dihydrochloride (PubChem CID 119888242) has the molecular formula C12H25Cl2N3O and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-amino-2-methyl-1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propan-1-one;dihydrochloride.
| Compound Name | 2-amino-2-methyl-1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119888242 |
| Molecular Formula | C12H25Cl2N3O |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-amino-2-methyl-1-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propan-1-one;dihydrochloride |
| SMILES | CC1CN2CCCC2CN1C(=O)C(C)(C)N.Cl.Cl |
| InChI | InChI=1S/C12H23N3O.2ClH/c1-9-7-14-6-4-5-10(14)8-15(9)11(16)12(2,3)13;;/h9-10H,4-8,13H2,1-3H3;2*1H |
| InChIKey | DRDYHPAMTFDHFG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |