C16H29N3OS — CID 79922230
2-ethyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)butanethioamide (PubChem CID 79922230) has the molecular formula C16H29N3OS and a molecular weight of 311.50 g/mol. Its IUPAC name is 2-ethyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)butanethioamide.
| Compound Name | 2-ethyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)butanethioamide |
|---|---|
| PubChem CID | 79922230 |
| Molecular Formula | C16H29N3OS |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-ethyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbonyl)butanethioamide |
| SMILES | CCC(CC)(C(=O)N1CC2CCCCN2CC1C)C(N)=S |
| InChI | InChI=1S/C16H29N3OS/c1-4-16(5-2,14(17)21)15(20)19-11-13-8-6-7-9-18(13)10-12(19)3/h12-13H,4-11H2,1-3H3,(H2,17,21) |
| InChIKey | KBVJXAFZYNFVPI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|