C14H25ClN2O — CID 79931600
3-chloro-2,2-dimethyl-1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-one (PubChem CID 79931600) has the molecular formula C14H25ClN2O and a molecular weight of 272.82 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-one |
|---|---|
| PubChem CID | 79931600 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-one |
| SMILES | CC1CN2CCCCC2CN1C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C14H25ClN2O/c1-11-8-16-7-5-4-6-12(16)9-17(11)13(18)14(2,3)10-15/h11-12H,4-10H2,1-3H3 |
| InChIKey | SOTIMYNATHYYPE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|