C14H25ClN2O — CID 55245823
3-chloro-1-(4-cyclopentylpiperazin-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 55245823) has the molecular formula C14H25ClN2O and a molecular weight of 272.82 g/mol. Its IUPAC name is 3-chloro-1-(4-cyclopentylpiperazin-1-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(4-cyclopentylpiperazin-1-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 55245823 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-chloro-1-(4-cyclopentylpiperazin-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C14H25ClN2O/c1-14(2,11-15)13(18)17-9-7-16(8-10-17)12-5-3-4-6-12/h12H,3-11H2,1-2H3 |
| InChIKey | JLFVVJUYZSHDKQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|