C12H23Cl2N3OS — CID 119888302
(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(1,3-thiazolidin-4-yl)methanone;dihydrochloride (PubChem CID 119888302) has the molecular formula C12H23Cl2N3OS and a molecular weight of 328.31 g/mol. Its IUPAC name is (3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(1,3-thiazolidin-4-yl)methanone;dihydrochloride.
| Compound Name | (3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(1,3-thiazolidin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119888302 |
| Molecular Formula | C12H23Cl2N3OS |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(1,3-thiazolidin-4-yl)methanone;dihydrochloride |
| SMILES | CC1CN2CCCC2CN1C(=O)C1CSCN1.Cl.Cl |
| InChI | InChI=1S/C12H21N3OS.2ClH/c1-9-5-14-4-2-3-10(14)6-15(9)12(16)11-7-17-8-13-11;;/h9-11,13H,2-8H2,1H3;2*1H |
| InChIKey | SJNFAMZDMWNHRQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |