C14H26N4O — CID 79938706
(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(5-methylpiperazin-2-yl)methanone (PubChem CID 79938706) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is (3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(5-methylpiperazin-2-yl)methanone.
| Compound Name | (3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(5-methylpiperazin-2-yl)methanone |
|---|---|
| PubChem CID | 79938706 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-(5-methylpiperazin-2-yl)methanone |
| SMILES | CC1CNC(C(=O)N2CC3CCCN3CC2C)CN1 |
| InChI | InChI=1S/C14H26N4O/c1-10-6-16-13(7-15-10)14(19)18-9-12-4-3-5-17(12)8-11(18)2/h10-13,15-16H,3-9H2,1-2H3 |
| InChIKey | JXYSMUGGOIXHRC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |