C10H11NO4 — CID 174683754
4-aminooxy-1-(4-hydroxyphenyl)butane-1,3-dione (PubChem CID 174683754) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 4-aminooxy-1-(4-hydroxyphenyl)butane-1,3-dione.
| Compound Name | 4-aminooxy-1-(4-hydroxyphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 174683754 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4-aminooxy-1-(4-hydroxyphenyl)butane-1,3-dione |
| SMILES | NOCC(=O)CC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H11NO4/c11-15-6-9(13)5-10(14)7-1-3-8(12)4-2-7/h1-4,12H,5-6,11H2 |
| InChIKey | XAIWSYVOCOGSDO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|