C14H18ClNO2 — CID 174686356
(E)-4-[4-[(2S)-pyrrolidin-2-yl]phenyl]but-2-enoic acid;hydrochloride (PubChem CID 174686356) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (E)-4-[4-[(2S)-pyrrolidin-2-yl]phenyl]but-2-enoic acid;hydrochloride.
| Compound Name | (E)-4-[4-[(2S)-pyrrolidin-2-yl]phenyl]but-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 174686356 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (E)-4-[4-[(2S)-pyrrolidin-2-yl]phenyl]but-2-enoic acid;hydrochloride |
| SMILES | Cl.O=C(O)/C=C/Cc1ccc([C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C14H17NO2.ClH/c16-14(17)5-1-3-11-6-8-12(9-7-11)13-4-2-10-15-13;/h1,5-9,13,15H,2-4,10H2,(H,16,17);1H/b5-1+;/t13-;/m0./s1 |
| InChIKey | WGSCRFKCGHELSV-RKBKZLIKSA-N |
| XLogP | 2.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|