C13H14FNO2 — CID 66519332
(E)-3-[2-fluoro-5-[(2R)-pyrrolidin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 66519332) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is (E)-3-[2-fluoro-5-[(2R)-pyrrolidin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-fluoro-5-[(2R)-pyrrolidin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66519332 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (E)-3-[2-fluoro-5-[(2R)-pyrrolidin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc([C@H]2CCCN2)ccc1F |
| InChI | InChI=1S/C13H14FNO2/c14-11-5-3-10(12-2-1-7-15-12)8-9(11)4-6-13(16)17/h3-6,8,12,15H,1-2,7H2,(H,16,17)/b6-4+/t12-/m1/s1 |
| InChIKey | GPBJGLFTCCKASM-FVOPLDGLSA-N |
| XLogP | 2.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|