About dioxane;hept-6-ene-1-sulfonyl chloride
dioxane;hept-6-ene-1-sulfonyl chloride (PubChem CID 174687063) has the molecular formula C11H21ClO4S
and a molecular weight of 284.80 g/mol. Its IUPAC name is dioxane;hept-6-ene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | dioxane;hept-6-ene-1-sulfonyl chloride |
| PubChem CID | 174687063 |
| Molecular Formula | C11H21ClO4S |
| Molecular Weight | 284.80 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | dioxane;hept-6-ene-1-sulfonyl chloride |
| SMILES | C1CCOOC1.C=CCCCCCS(=O)(=O)Cl |
| InChI | InChI=1S/C7H13ClO2S.C4H8O2/c1-2-3-4-5-6-7-11(8,9)10;1-2-4-6-5-3-1/h2H,1,3-7H2;1-4H2 |
| InChIKey | UEWVUKZBHNEMIR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.80 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze dioxane;hept-6-ene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxane;hept-6-ene-1-sulfonyl chloride?
The IUPAC name of dioxane;hept-6-ene-1-sulfonyl chloride (CID 174687063) is dioxane;hept-6-ene-1-sulfonyl chloride.
What is the SMILES notation for dioxane;hept-6-ene-1-sulfonyl chloride?
The canonical SMILES for dioxane;hept-6-ene-1-sulfonyl chloride is C1CCOOC1.C=CCCCCCS(=O)(=O)Cl.
What is the InChIKey of dioxane;hept-6-ene-1-sulfonyl chloride?
The InChIKey is UEWVUKZBHNEMIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO2S.C4H8O2/c1-2-3-4-5-6-7-11(8,9)10;1-2-4-6-5-3-1/h2H,1,3-7H2;1-4H2.
What are the key properties of dioxane;hept-6-ene-1-sulfonyl chloride?
dioxane;hept-6-ene-1-sulfonyl chloride has a molecular weight of 284.80 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxane;hept-6-ene-1-sulfonyl chloride is sourced from PubChem (CID 174687063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).