About 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid
3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid (PubChem CID 174689541) has the molecular formula C13H18F2N4O4
and a molecular weight of 332.31 g/mol. Its IUPAC name is 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid |
| PubChem CID | 174689541 |
| Molecular Formula | C13H18F2N4O4 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid |
| SMILES | CC(F)(F)COC1CN(C(=O)O)CCC1NC(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C13H18F2N4O4/c1-13(14,15)7-23-9-6-19(12(21)22)5-2-8(9)18-11(20)10-16-3-4-17-10/h3-4,8-9H,2,5-7H2,1H3,(H,16,17)(H,18,20)(H,21,22) |
| InChIKey | REEIRIPVIFHQMH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid?
The IUPAC name of 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid (CID 174689541) is 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid.
What is the SMILES notation for 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid?
The canonical SMILES for 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid is CC(F)(F)COC1CN(C(=O)O)CCC1NC(=O)c1ncc[nH]1.
What is the InChIKey of 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid?
The InChIKey is REEIRIPVIFHQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N4O4/c1-13(14,15)7-23-9-6-19(12(21)22)5-2-8(9)18-11(20)10-16-3-4-17-10/h3-4,8-9H,2,5-7H2,1H3,(H,16,17)(H,18,20)(H,21,22).
What are the key properties of 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid?
3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid has a molecular weight of 332.31 g/mol, XLogP of 0.93, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoropropoxy)-4-(1H-imidazole-2-carbonylamino)piperidine-1-carboxylic acid is sourced from PubChem (CID 174689541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).