C30H27N3O6 — CID 174694219
N-[1-[4-(4-aminophenoxy)phenyl]-1-oxo-3-phenylmethoxypropan-2-yl]-3-methyl-2-nitrobenzamide (PubChem CID 174694219) has the molecular formula C30H27N3O6 and a molecular weight of 525.56 g/mol. Its IUPAC name is N-[1-[4-(4-aminophenoxy)phenyl]-1-oxo-3-phenylmethoxypropan-2-yl]-3-methyl-2-nitrobenzamide.
| Compound Name | N-[1-[4-(4-aminophenoxy)phenyl]-1-oxo-3-phenylmethoxypropan-2-yl]-3-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 174694219 |
| Molecular Formula | C30H27N3O6 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-[1-[4-(4-aminophenoxy)phenyl]-1-oxo-3-phenylmethoxypropan-2-yl]-3-methyl-2-nitrobenzamide |
| SMILES | Cc1cccc(C(=O)NC(COCc2ccccc2)C(=O)c2ccc(Oc3ccc(N)cc3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C30H27N3O6/c1-20-6-5-9-26(28(20)33(36)37)30(35)32-27(19-38-18-21-7-3-2-4-8-21)29(34)22-10-14-24(15-11-22)39-25-16-12-23(31)13-17-25/h2-17,27H,18-19,31H2,1H3,(H,32,35) |
| InChIKey | CWMGILGYIJHPAD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|