C31H28N2O5 — CID 58523073
3-methyl-2-nitroso-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]benzamide (PubChem CID 58523073) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is 3-methyl-2-nitroso-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]benzamide.
| Compound Name | 3-methyl-2-nitroso-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]benzamide |
|---|---|
| PubChem CID | 58523073 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 3-methyl-2-nitroso-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)NC(COCc2ccccc2)C(=O)Cc2ccc(Oc3ccccc3)cc2)c1N=O |
| InChI | InChI=1S/C31H28N2O5/c1-22-9-8-14-27(30(22)33-36)31(35)32-28(21-37-20-24-10-4-2-5-11-24)29(34)19-23-15-17-26(18-16-23)38-25-12-6-3-7-13-25/h2-18,28H,19-21H2,1H3,(H,32,35) |
| InChIKey | NXGVPVDXBCIGCY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |