C31H27NO5 — CID 58523214
2-oxo-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide (PubChem CID 58523214) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is 2-oxo-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide.
| Compound Name | 2-oxo-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 58523214 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-oxo-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide |
| SMILES | O=C(NC(COCc1ccccc1)C(=O)Cc1ccc(Oc2ccccc2)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H27NO5/c33-29(20-23-16-18-27(19-17-23)37-26-14-8-3-9-15-26)28(22-36-21-24-10-4-1-5-11-24)32-31(35)30(34)25-12-6-2-7-13-25/h1-19,28H,20-22H2,(H,32,35) |
| InChIKey | NIRQTUKQUPYYMB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|