C29H33NO4 — CID 58523151
N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]hexanamide (PubChem CID 58523151) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]hexanamide.
| Compound Name | N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 58523151 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)NC(COCc1ccccc1)C(=O)Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33NO4/c1-2-3-6-15-29(32)30-27(22-33-21-24-11-7-4-8-12-24)28(31)20-23-16-18-26(19-17-23)34-25-13-9-5-10-14-25/h4-5,7-14,16-19,27H,2-3,6,15,20-22H2,1H3,(H,30,32) |
| InChIKey | RSNQHUOQXXWDJW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|