C32H31NO5 — CID 58523051
2-methoxy-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide (PubChem CID 58523051) has the molecular formula C32H31NO5 and a molecular weight of 509.60 g/mol. Its IUPAC name is 2-methoxy-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide.
| Compound Name | 2-methoxy-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 58523051 |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 2-methoxy-N-[3-oxo-4-(4-phenoxyphenyl)-1-phenylmethoxybutan-2-yl]-2-phenylacetamide |
| SMILES | COC(C(=O)NC(COCc1ccccc1)C(=O)Cc1ccc(Oc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H31NO5/c1-36-31(26-13-7-3-8-14-26)32(35)33-29(23-37-22-25-11-5-2-6-12-25)30(34)21-24-17-19-28(20-18-24)38-27-15-9-4-10-16-27/h2-20,29,31H,21-23H2,1H3,(H,33,35) |
| InChIKey | WKKMSVIVWNWCIZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |