C19H21NO — CID 174694435
7-(3-phenylbutyl)-2,3-dihydro-1H-isoindole-1-carbaldehyde (PubChem CID 174694435) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 7-(3-phenylbutyl)-2,3-dihydro-1H-isoindole-1-carbaldehyde.
| Compound Name | 7-(3-phenylbutyl)-2,3-dihydro-1H-isoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174694435 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 7-(3-phenylbutyl)-2,3-dihydro-1H-isoindole-1-carbaldehyde |
| SMILES | CC(CCc1cccc2c1C(C=O)NC2)c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-14(15-6-3-2-4-7-15)10-11-16-8-5-9-17-12-20-18(13-21)19(16)17/h2-9,13-14,18,20H,10-12H2,1H3 |
| InChIKey | OEYRRSZDANTNRG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|