C18H19O6+ — CID 174695330
2,2-bis(4-hydroxy-3-methoxyphenyl)-3-oxobutanal;hydron (PubChem CID 174695330) has the molecular formula C18H19O6+ and a molecular weight of 331.34 g/mol. Its IUPAC name is 2,2-bis(4-hydroxy-3-methoxyphenyl)-3-oxobutanal;hydron.
| Compound Name | 2,2-bis(4-hydroxy-3-methoxyphenyl)-3-oxobutanal;hydron |
|---|---|
| PubChem CID | 174695330 |
| Molecular Formula | C18H19O6+ |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2,2-bis(4-hydroxy-3-methoxyphenyl)-3-oxobutanal;hydron |
| SMILES | COc1cc(C(C=O)(C(C)=O)c2ccc(O)c(OC)c2)ccc1O.[H+] |
| InChI | InChI=1S/C18H18O6/c1-11(20)18(10-19,12-4-6-14(21)16(8-12)23-2)13-5-7-15(22)17(9-13)24-3/h4-10,21-22H,1-3H3/p+1 |
| InChIKey | KRWUZAGYDRPDMP-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|