About phenyl 4-nitrohexanoate
phenyl 4-nitrohexanoate (PubChem CID 174696245) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is phenyl 4-nitrohexanoate.
Molecular Properties
| Compound Name | phenyl 4-nitrohexanoate |
| PubChem CID | 174696245 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | phenyl 4-nitrohexanoate |
| SMILES | CCC(CCC(=O)Oc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO4/c1-2-10(13(15)16)8-9-12(14)17-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | NJNQDFWTAAOHBO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-nitrohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-nitrohexanoate?
The IUPAC name of phenyl 4-nitrohexanoate (CID 174696245) is phenyl 4-nitrohexanoate.
What is the SMILES notation for phenyl 4-nitrohexanoate?
The canonical SMILES for phenyl 4-nitrohexanoate is CCC(CCC(=O)Oc1ccccc1)[N+](=O)[O-].
What is the InChIKey of phenyl 4-nitrohexanoate?
The InChIKey is NJNQDFWTAAOHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-2-10(13(15)16)8-9-12(14)17-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3.
What are the key properties of phenyl 4-nitrohexanoate?
phenyl 4-nitrohexanoate has a molecular weight of 237.25 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-nitrohexanoate is sourced from PubChem (CID 174696245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).