C14H15ClN2O2S — CID 174696301
2-chloro-N-(2-ethylthiophen-3-yl)pyridin-4-amine;prop-2-enoic acid (PubChem CID 174696301) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 2-chloro-N-(2-ethylthiophen-3-yl)pyridin-4-amine;prop-2-enoic acid.
| Compound Name | 2-chloro-N-(2-ethylthiophen-3-yl)pyridin-4-amine;prop-2-enoic acid |
|---|---|
| PubChem CID | 174696301 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-chloro-N-(2-ethylthiophen-3-yl)pyridin-4-amine;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCc1sccc1Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2S.C3H4O2/c1-2-10-9(4-6-15-10)14-8-3-5-13-11(12)7-8;1-2-3(4)5/h3-7H,2H2,1H3,(H,13,14);2H,1H2,(H,4,5) |
| InChIKey | HCQXCRTWJZFWPK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|