C21H23N3O4 — CID 174699168
methyl N-[2-[(1,4-dimethyl-3-phenylpyrazol-5-yl)-hydroxymethyl]phenyl]-N-methoxycarbamate (PubChem CID 174699168) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl N-[2-[(1,4-dimethyl-3-phenylpyrazol-5-yl)-hydroxymethyl]phenyl]-N-methoxycarbamate.
| Compound Name | methyl N-[2-[(1,4-dimethyl-3-phenylpyrazol-5-yl)-hydroxymethyl]phenyl]-N-methoxycarbamate |
|---|---|
| PubChem CID | 174699168 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl N-[2-[(1,4-dimethyl-3-phenylpyrazol-5-yl)-hydroxymethyl]phenyl]-N-methoxycarbamate |
| SMILES | COC(=O)N(OC)c1ccccc1C(O)c1c(C)c(-c2ccccc2)nn1C |
| InChI | InChI=1S/C21H23N3O4/c1-14-18(15-10-6-5-7-11-15)22-23(2)19(14)20(25)16-12-8-9-13-17(16)24(28-4)21(26)27-3/h5-13,20,25H,1-4H3 |
| InChIKey | XDXLEECWYOOIMN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|