About 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide
3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide (PubChem CID 134704073) has the molecular formula C17H17F2N5O
and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide |
| PubChem CID | 134704073 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cc1c(-c2ccccc2)nn(C)c1NC(=O)c1cc(C(F)F)nn1C |
| InChI | InChI=1S/C17H17F2N5O/c1-10-14(11-7-5-4-6-8-11)22-24(3)16(10)20-17(25)13-9-12(15(18)19)21-23(13)2/h4-9,15H,1-3H3,(H,20,25) |
| InChIKey | YDIVTHUFMZYOSS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide?
The IUPAC name of 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide (CID 134704073) is 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide.
What is the SMILES notation for 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide?
The canonical SMILES for 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide is Cc1c(-c2ccccc2)nn(C)c1NC(=O)c1cc(C(F)F)nn1C.
What is the InChIKey of 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide?
The InChIKey is YDIVTHUFMZYOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N5O/c1-10-14(11-7-5-4-6-8-11)22-24(3)16(10)20-17(25)13-9-12(15(18)19)21-23(13)2/h4-9,15H,1-3H3,(H,20,25).
What are the key properties of 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide?
3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide has a molecular weight of 345.35 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-N-(1,4-dimethyl-3-phenylpyrazol-5-yl)-1-methylpyrazole-5-carboxamide is sourced from PubChem (CID 134704073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).