C23H21ClN4O2 — CID 170413053
N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1,4-dimethylpyrazol-5-yl]benzamide (PubChem CID 170413053) has the molecular formula C23H21ClN4O2 and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1,4-dimethylpyrazol-5-yl]benzamide.
| Compound Name | N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1,4-dimethylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 170413053 |
| Molecular Formula | C23H21ClN4O2 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[3-[4-[(3-chloro-2-methylidenebut-3-enoyl)amino]phenyl]-1,4-dimethylpyrazol-5-yl]benzamide |
| SMILES | C=C(Cl)C(=C)C(=O)Nc1ccc(-c2nn(C)c(NC(=O)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C23H21ClN4O2/c1-14(16(3)24)22(29)25-19-12-10-17(11-13-19)20-15(2)21(28(4)27-20)26-23(30)18-8-6-5-7-9-18/h5-13H,1,3H2,2,4H3,(H,25,29)(H,26,30) |
| InChIKey | OPVZWAJFBQCXOD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|