C28H24F3N5O4S — CID 176898793
S-[[[4-[1,4-dimethyl-5-[[4-(trifluoromethoxy)benzoyl]amino]pyrazol-3-yl]phenyl]-methylcarbamoyl]amino] benzenecarbothioate (PubChem CID 176898793) has the molecular formula C28H24F3N5O4S and a molecular weight of 583.59 g/mol. Its IUPAC name is S-[[[4-[1,4-dimethyl-5-[[4-(trifluoromethoxy)benzoyl]amino]pyrazol-3-yl]phenyl]-methylcarbamoyl]amino] benzenecarbothioate.
| Compound Name | S-[[[4-[1,4-dimethyl-5-[[4-(trifluoromethoxy)benzoyl]amino]pyrazol-3-yl]phenyl]-methylcarbamoyl]amino] benzenecarbothioate |
|---|---|
| PubChem CID | 176898793 |
| Molecular Formula | C28H24F3N5O4S |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | S-[[[4-[1,4-dimethyl-5-[[4-(trifluoromethoxy)benzoyl]amino]pyrazol-3-yl]phenyl]-methylcarbamoyl]amino] benzenecarbothioate |
| SMILES | Cc1c(-c2ccc(N(C)C(=O)NSC(=O)c3ccccc3)cc2)nn(C)c1NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C28H24F3N5O4S/c1-17-23(33-36(3)24(17)32-25(37)19-11-15-22(16-12-19)40-28(29,30)31)18-9-13-21(14-10-18)35(2)27(39)34-41-26(38)20-7-5-4-6-8-20/h4-16H,1-3H3,(H,32,37)(H,34,39) |
| InChIKey | ZQUCPWXMTYLGOW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|