C18H25NO4 — CID 174699546
(2E,4E)-hexa-2,4-dienoic acid;propyl 2-amino-3-phenylpropanoate (PubChem CID 174699546) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienoic acid;propyl 2-amino-3-phenylpropanoate.
| Compound Name | (2E,4E)-hexa-2,4-dienoic acid;propyl 2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 174699546 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienoic acid;propyl 2-amino-3-phenylpropanoate |
| SMILES | C/C=C/C=C/C(=O)O.CCCOC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C12H17NO2.C6H8O2/c1-2-8-15-12(14)11(13)9-10-6-4-3-5-7-10;1-2-3-4-5-6(7)8/h3-7,11H,2,8-9,13H2,1H3;2-5H,1H3,(H,7,8)/b;3-2+,5-4+ |
| InChIKey | QHJMYTUNVGLHTG-PLKIVWSFSA-N |
| XLogP | 2.71 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|