C18H23FN4O3 — CID 174700580
[4-(1-ethyl-6-fluoropyrrolo[2,3-b]pyridin-3-yl)-3-oxopiperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174700580) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is [4-(1-ethyl-6-fluoropyrrolo[2,3-b]pyridin-3-yl)-3-oxopiperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(1-ethyl-6-fluoropyrrolo[2,3-b]pyridin-3-yl)-3-oxopiperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174700580 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [4-(1-ethyl-6-fluoropyrrolo[2,3-b]pyridin-3-yl)-3-oxopiperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CCn1cc(N2CCN(OC(=O)C(C)(C)C)CC2=O)c2ccc(F)nc21 |
| InChI | InChI=1S/C18H23FN4O3/c1-5-21-10-13(12-6-7-14(19)20-16(12)21)23-9-8-22(11-15(23)24)26-17(25)18(2,3)4/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | NGFQNZGWKHWGRV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|