About 2-benzyl-1H-indene;tetrabromozirconium
2-benzyl-1H-indene;tetrabromozirconium (PubChem CID 174700652) has the molecular formula C16H14Br4Zr
and a molecular weight of 617.13 g/mol. Its IUPAC name is 2-benzyl-1H-indene;tetrabromozirconium.
Molecular Properties
| Compound Name | 2-benzyl-1H-indene;tetrabromozirconium |
| PubChem CID | 174700652 |
| Molecular Formula | C16H14Br4Zr |
| Molecular Weight | 617.13 g/mol |
| Exact Mass | 611.69 |
| IUPAC Name | 2-benzyl-1H-indene;tetrabromozirconium |
| SMILES | Br[Zr](Br)(Br)Br.C1=C(Cc2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C16H14.4BrH.Zr/c1-2-6-13(7-3-1)10-14-11-15-8-4-5-9-16(15)12-14;;;;;/h1-9,11H,10,12H2;4*1H;/q;;;;;+4/p-4 |
| InChIKey | OJKMKLOCNVRCMK-UHFFFAOYSA-J |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 617.13 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-benzyl-1H-indene;tetrabromozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-indene;tetrabromozirconium?
The IUPAC name of 2-benzyl-1H-indene;tetrabromozirconium (CID 174700652) is 2-benzyl-1H-indene;tetrabromozirconium.
What is the SMILES notation for 2-benzyl-1H-indene;tetrabromozirconium?
The canonical SMILES for 2-benzyl-1H-indene;tetrabromozirconium is Br[Zr](Br)(Br)Br.C1=C(Cc2ccccc2)Cc2ccccc21.
What is the InChIKey of 2-benzyl-1H-indene;tetrabromozirconium?
The InChIKey is OJKMKLOCNVRCMK-UHFFFAOYSA-J. The full InChI is InChI=1S/C16H14.4BrH.Zr/c1-2-6-13(7-3-1)10-14-11-15-8-4-5-9-16(15)12-14;;;;;/h1-9,11H,10,12H2;4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-benzyl-1H-indene;tetrabromozirconium?
2-benzyl-1H-indene;tetrabromozirconium has a molecular weight of 617.13 g/mol, XLogP of 7.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-indene;tetrabromozirconium is sourced from PubChem (CID 174700652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).