C24H28N6O2 — CID 174701613
[1-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]azetidin-3-yl] N-tert-butylcarbamate (PubChem CID 174701613) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is [1-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]azetidin-3-yl] N-tert-butylcarbamate.
| Compound Name | [1-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]azetidin-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174701613 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [1-[3-(1-quinolin-2-ylazetidin-3-yl)pyrazin-2-yl]azetidin-3-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CN(c2nccnc2C2CN(c3ccc4ccccc4n3)C2)C1 |
| InChI | InChI=1S/C24H28N6O2/c1-24(2,3)28-23(31)32-18-14-30(15-18)22-21(25-10-11-26-22)17-12-29(13-17)20-9-8-16-6-4-5-7-19(16)27-20/h4-11,17-18H,12-15H2,1-3H3,(H,28,31) |
| InChIKey | SEKDXKKLDMKEBM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |