C24H29N5 — CID 70166868
2-[3-[3-[(3R)-3-ethylazepan-1-yl]pyrazin-2-yl]azetidin-1-yl]quinoline (PubChem CID 70166868) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[3-[3-[(3R)-3-ethylazepan-1-yl]pyrazin-2-yl]azetidin-1-yl]quinoline.
| Compound Name | 2-[3-[3-[(3R)-3-ethylazepan-1-yl]pyrazin-2-yl]azetidin-1-yl]quinoline |
|---|---|
| PubChem CID | 70166868 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-[3-[3-[(3R)-3-ethylazepan-1-yl]pyrazin-2-yl]azetidin-1-yl]quinoline |
| SMILES | CC[C@@H]1CCCCN(c2nccnc2C2CN(c3ccc4ccccc4n3)C2)C1 |
| InChI | InChI=1S/C24H29N5/c1-2-18-7-5-6-14-28(15-18)24-23(25-12-13-26-24)20-16-29(17-20)22-11-10-19-8-3-4-9-21(19)27-22/h3-4,8-13,18,20H,2,5-7,14-17H2,1H3/t18-/m1/s1 |
| InChIKey | GYRANJQGOGIGFT-GOSISDBHSA-N |
| XLogP | 4.65 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |