About (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane
(3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane (PubChem CID 174702002) has the molecular formula C9H12N2Sn
and a molecular weight of 266.92 g/mol. Its IUPAC name is (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane.
Molecular Properties
| Compound Name | (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane |
| PubChem CID | 174702002 |
| Molecular Formula | C9H12N2Sn |
| Molecular Weight | 266.92 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane |
| SMILES | [SnH]N1CCC(c2ccncc2)C1 |
| InChI | InChI=1S/C9H11N2.Sn.H/c1-4-10-5-2-8(1)9-3-6-11-7-9;;/h1-2,4-5,9H,3,6-7H2;;/q-1;+1; |
| InChIKey | DUYMUOAVUCXFCX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.92 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane?
The IUPAC name of (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane (CID 174702002) is (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane.
What is the SMILES notation for (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane?
The canonical SMILES for (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane is [SnH]N1CCC(c2ccncc2)C1.
What is the InChIKey of (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane?
The InChIKey is DUYMUOAVUCXFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N2.Sn.H/c1-4-10-5-2-8(1)9-3-6-11-7-9;;/h1-2,4-5,9H,3,6-7H2;;/q-1;+1;.
What are the key properties of (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane?
(3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane has a molecular weight of 266.92 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pyridin-4-ylpyrrolidin-1-yl)-λ2-stannane is sourced from PubChem (CID 174702002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).