C11H15N3S — CID 154522101
4-pyridin-4-ylpiperidine-1-carbothioamide (PubChem CID 154522101) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-pyridin-4-ylpiperidine-1-carbothioamide.
| Compound Name | 4-pyridin-4-ylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 154522101 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-pyridin-4-ylpiperidine-1-carbothioamide |
| SMILES | NC(=S)N1CCC(c2ccncc2)CC1 |
| InChI | InChI=1S/C11H15N3S/c12-11(15)14-7-3-10(4-8-14)9-1-5-13-6-2-9/h1-2,5-6,10H,3-4,7-8H2,(H2,12,15) |
| InChIKey | FNUAYCBRECAXNO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|