C14H15N3OS — CID 95833568
(4-pyridin-4-ylpiperidin-1-yl)-(1,2-thiazol-4-yl)methanone (PubChem CID 95833568) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is (4-pyridin-4-ylpiperidin-1-yl)-(1,2-thiazol-4-yl)methanone.
| Compound Name | (4-pyridin-4-ylpiperidin-1-yl)-(1,2-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 95833568 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (4-pyridin-4-ylpiperidin-1-yl)-(1,2-thiazol-4-yl)methanone |
| SMILES | O=C(c1cnsc1)N1CCC(c2ccncc2)CC1 |
| InChI | InChI=1S/C14H15N3OS/c18-14(13-9-16-19-10-13)17-7-3-12(4-8-17)11-1-5-15-6-2-11/h1-2,5-6,9-10,12H,3-4,7-8H2 |
| InChIKey | CWSOWIRDFLFZRS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |