C13H18N2O4S — CID 174702855
6-(diethoxymethyl)-1-methylsulfonylpyrrolo[3,2-c]pyridine (PubChem CID 174702855) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 6-(diethoxymethyl)-1-methylsulfonylpyrrolo[3,2-c]pyridine.
| Compound Name | 6-(diethoxymethyl)-1-methylsulfonylpyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 174702855 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 6-(diethoxymethyl)-1-methylsulfonylpyrrolo[3,2-c]pyridine |
| SMILES | CCOC(OCC)c1cc2c(ccn2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C13H18N2O4S/c1-4-18-13(19-5-2)11-8-12-10(9-14-11)6-7-15(12)20(3,16)17/h6-9,13H,4-5H2,1-3H3 |
| InChIKey | DDWYZLHWUYUUOL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|