C14H9F3N2O2S — CID 150655261
1-(benzenesulfonyl)-6-(trifluoromethyl)pyrrolo[3,2-c]pyridine (PubChem CID 150655261) has the molecular formula C14H9F3N2O2S and a molecular weight of 326.30 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-(trifluoromethyl)pyrrolo[3,2-c]pyridine.
| Compound Name | 1-(benzenesulfonyl)-6-(trifluoromethyl)pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 150655261 |
| Molecular Formula | C14H9F3N2O2S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-(benzenesulfonyl)-6-(trifluoromethyl)pyrrolo[3,2-c]pyridine |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2cnc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H9F3N2O2S/c15-14(16,17)13-8-12-10(9-18-13)6-7-19(12)22(20,21)11-4-2-1-3-5-11/h1-9H |
| InChIKey | JCSHJSJOLHPIGL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |