C17H12N2O2S — CID 15474221
1-(benzenesulfonyl)pyrrolo[3,2-c]isoquinoline (PubChem CID 15474221) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-(benzenesulfonyl)pyrrolo[3,2-c]isoquinoline.
| Compound Name | 1-(benzenesulfonyl)pyrrolo[3,2-c]isoquinoline |
|---|---|
| PubChem CID | 15474221 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-(benzenesulfonyl)pyrrolo[3,2-c]isoquinoline |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2ncc3ccccc3c21 |
| InChI | InChI=1S/C17H12N2O2S/c20-22(21,14-7-2-1-3-8-14)19-11-10-16-17(19)15-9-5-4-6-13(15)12-18-16/h1-12H |
| InChIKey | MOECSSXSYNPBFI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |