C33H31N5O3 — CID 174703326
1-[4-[4-[[4-(4-hydroxypiperidin-1-yl)benzoyl]amino]anilino]phenyl]indole-6-carboxamide (PubChem CID 174703326) has the molecular formula C33H31N5O3 and a molecular weight of 545.64 g/mol. Its IUPAC name is 1-[4-[4-[[4-(4-hydroxypiperidin-1-yl)benzoyl]amino]anilino]phenyl]indole-6-carboxamide.
| Compound Name | 1-[4-[4-[[4-(4-hydroxypiperidin-1-yl)benzoyl]amino]anilino]phenyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 174703326 |
| Molecular Formula | C33H31N5O3 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 1-[4-[4-[[4-(4-hydroxypiperidin-1-yl)benzoyl]amino]anilino]phenyl]indole-6-carboxamide |
| SMILES | NC(=O)c1ccc2ccn(-c3ccc(Nc4ccc(NC(=O)c5ccc(N6CCC(O)CC6)cc5)cc4)cc3)c2c1 |
| InChI | InChI=1S/C33H31N5O3/c34-32(40)24-2-1-22-15-20-38(31(22)21-24)29-13-9-26(10-14-29)35-25-5-7-27(8-6-25)36-33(41)23-3-11-28(12-4-23)37-18-16-30(39)17-19-37/h1-15,20-21,30,35,39H,16-19H2,(H2,34,40)(H,36,41) |
| InChIKey | JWWLSPURNHCCRM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |