C38H35N7O3 — CID 87274240
N-[1-[2-(cyanomethylamino)-2-oxoethyl]indol-5-yl]-4-[5-[4-(4-hydroxypiperidin-1-yl)anilino]indol-1-yl]benzamide (PubChem CID 87274240) has the molecular formula C38H35N7O3 and a molecular weight of 637.74 g/mol. Its IUPAC name is N-[1-[2-(cyanomethylamino)-2-oxoethyl]indol-5-yl]-4-[5-[4-(4-hydroxypiperidin-1-yl)anilino]indol-1-yl]benzamide.
| Compound Name | N-[1-[2-(cyanomethylamino)-2-oxoethyl]indol-5-yl]-4-[5-[4-(4-hydroxypiperidin-1-yl)anilino]indol-1-yl]benzamide |
|---|---|
| PubChem CID | 87274240 |
| Molecular Formula | C38H35N7O3 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | N-[1-[2-(cyanomethylamino)-2-oxoethyl]indol-5-yl]-4-[5-[4-(4-hydroxypiperidin-1-yl)anilino]indol-1-yl]benzamide |
| SMILES | N#CCNC(=O)Cn1ccc2cc(NC(=O)c3ccc(-n4ccc5cc(Nc6ccc(N7CCC(O)CC7)cc6)ccc54)cc3)ccc21 |
| InChI | InChI=1S/C38H35N7O3/c39-17-18-40-37(47)25-44-19-13-27-23-31(5-11-35(27)44)42-38(48)26-1-7-33(8-2-26)45-22-14-28-24-30(6-12-36(28)45)41-29-3-9-32(10-4-29)43-20-15-34(46)16-21-43/h1-14,19,22-24,34,41,46H,15-16,18,20-21,25H2,(H,40,47)(H,42,48) |
| InChIKey | XUZRLFOQNVKVGD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|