C30H30N6O2 — CID 67113155
N-[3-cyano-4-[4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1-methylpyrrole-3-carboxamide (PubChem CID 67113155) has the molecular formula C30H30N6O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is N-[3-cyano-4-[4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1-methylpyrrole-3-carboxamide.
| Compound Name | N-[3-cyano-4-[4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67113155 |
| Molecular Formula | C30H30N6O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-[3-cyano-4-[4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1-methylpyrrole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccc(Nc3ccc(Nc4ccc(N5CCC(O)CC5)cc4)cc3)c(C#N)c2)c1 |
| InChI | InChI=1S/C30H30N6O2/c1-35-15-12-21(20-35)30(38)34-26-8-11-29(22(18-26)19-31)33-25-4-2-23(3-5-25)32-24-6-9-27(10-7-24)36-16-13-28(37)14-17-36/h2-12,15,18,20,28,32-33,37H,13-14,16-17H2,1H3,(H,34,38) |
| InChIKey | GVILCVCAWYFMOZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 105.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|