C29H28N6O2 — CID 67113334
N-[4-[2-cyano-4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 67113334) has the molecular formula C29H28N6O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-[4-[2-cyano-4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[4-[2-cyano-4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67113334 |
| Molecular Formula | C29H28N6O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[4-[2-cyano-4-[4-(4-hydroxypiperidin-1-yl)anilino]anilino]phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | N#Cc1cc(Nc2ccc(N3CCC(O)CC3)cc2)ccc1Nc1ccc(NC(=O)c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C29H28N6O2/c30-18-21-17-25(32-22-5-8-26(9-6-22)35-15-12-27(36)13-16-35)7-10-28(21)33-23-1-3-24(4-2-23)34-29(37)20-11-14-31-19-20/h1-11,14,17,19,27,31-33,36H,12-13,15-16H2,(H,34,37) |
| InChIKey | WSIMTMHLRJPSLP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|