C23H18BrN3O4 — CID 174704591
methyl 8-bromo-5-hydroxy-2-oxo-1-(2-phenylethyl)-3-pyridin-3-yl-1,7-naphthyridine-6-carboxylate (PubChem CID 174704591) has the molecular formula C23H18BrN3O4 and a molecular weight of 480.32 g/mol. Its IUPAC name is methyl 8-bromo-5-hydroxy-2-oxo-1-(2-phenylethyl)-3-pyridin-3-yl-1,7-naphthyridine-6-carboxylate.
| Compound Name | methyl 8-bromo-5-hydroxy-2-oxo-1-(2-phenylethyl)-3-pyridin-3-yl-1,7-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 174704591 |
| Molecular Formula | C23H18BrN3O4 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | methyl 8-bromo-5-hydroxy-2-oxo-1-(2-phenylethyl)-3-pyridin-3-yl-1,7-naphthyridine-6-carboxylate |
| SMILES | COC(=O)c1nc(Br)c2c(cc(-c3cccnc3)c(=O)n2CCc2ccccc2)c1O |
| InChI | InChI=1S/C23H18BrN3O4/c1-31-23(30)18-20(28)17-12-16(15-8-5-10-25-13-15)22(29)27(19(17)21(24)26-18)11-9-14-6-3-2-4-7-14/h2-8,10,12-13,28H,9,11H2,1H3 |
| InChIKey | ZKGOSSXYCNDLSX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|