C30H26N4O5S — CID 175388733
4-[[5-hydroxy-2-oxo-3-phenyl-1-(2-phenylethyl)-8-(1,3-thiazol-4-yl)-1,7-naphthyridine-6-carbonyl]amino]butanoic acid (PubChem CID 175388733) has the molecular formula C30H26N4O5S and a molecular weight of 554.63 g/mol. Its IUPAC name is 4-[[5-hydroxy-2-oxo-3-phenyl-1-(2-phenylethyl)-8-(1,3-thiazol-4-yl)-1,7-naphthyridine-6-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[5-hydroxy-2-oxo-3-phenyl-1-(2-phenylethyl)-8-(1,3-thiazol-4-yl)-1,7-naphthyridine-6-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175388733 |
| Molecular Formula | C30H26N4O5S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 4-[[5-hydroxy-2-oxo-3-phenyl-1-(2-phenylethyl)-8-(1,3-thiazol-4-yl)-1,7-naphthyridine-6-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)c1nc(-c2cscn2)c2c(cc(-c3ccccc3)c(=O)n2CCc2ccccc2)c1O |
| InChI | InChI=1S/C30H26N4O5S/c35-24(36)12-7-14-31-29(38)26-28(37)22-16-21(20-10-5-2-6-11-20)30(39)34(15-13-19-8-3-1-4-9-19)27(22)25(33-26)23-17-40-18-32-23/h1-6,8-11,16-18,37H,7,12-15H2,(H,31,38)(H,35,36) |
| InChIKey | ABMQBWYPTUXINU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|