C12H12N2O2 — CID 174706493
bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbonitrile;ethyl 3-aminoprop-2-enoate (PubChem CID 174706493) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbonitrile;ethyl 3-aminoprop-2-enoate.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbonitrile;ethyl 3-aminoprop-2-enoate |
|---|---|
| PubChem CID | 174706493 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbonitrile;ethyl 3-aminoprop-2-enoate |
| SMILES | CCOC(=O)C=CN.N#Cc1c2cccc1-2 |
| InChI | InChI=1S/C7H3N.C5H9NO2/c8-4-7-5-2-1-3-6(5)7;1-2-8-5(7)3-4-6/h1-3H;3-4H,2,6H2,1H3 |
| InChIKey | YURUVQFDZCNYDO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|