5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid

C13H12ClN3O2 — CID 174708673

IUPAC5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid
SMILESCc1cc(Nc2ccnc(Cl)n2)cc(C(=O)O)c1C
InChIInChI=1S/C13H12ClN3O2/c1-7-5-9(6-10(8(7)2)12(18)19)16-11-3-4-15-13(14)17-11/h3-6H,1-2H3,(H,18,19)(H,15,16,17)
InChIKeyXGUDBPMBXRDMEN-UHFFFAOYSA-N
MW277.71 g/mol
LogP3.19
Rot. Bonds3

About 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid

5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid (PubChem CID 174708673) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid.

Molecular Properties

Compound Name5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid
PubChem CID174708673
Molecular FormulaC13H12ClN3O2
Molecular Weight277.71 g/mol
Exact Mass277.06
IUPAC Name5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid
SMILESCc1cc(Nc2ccnc(Cl)n2)cc(C(=O)O)c1C
InChIInChI=1S/C13H12ClN3O2/c1-7-5-9(6-10(8(7)2)12(18)19)16-11-3-4-15-13(14)17-11/h3-6H,1-2H3,(H,18,19)(H,15,16,17)
InChIKeyXGUDBPMBXRDMEN-UHFFFAOYSA-N
XLogP3.19
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.71
LogP ≤ 53.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid?
The IUPAC name of 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid (CID 174708673) is 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid.
What is the SMILES notation for 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid?
The canonical SMILES for 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid is Cc1cc(Nc2ccnc(Cl)n2)cc(C(=O)O)c1C.
What is the InChIKey of 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid?
The InChIKey is XGUDBPMBXRDMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3O2/c1-7-5-9(6-10(8(7)2)12(18)19)16-11-3-4-15-13(14)17-11/h3-6H,1-2H3,(H,18,19)(H,15,16,17).
What are the key properties of 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid?
5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid has a molecular weight of 277.71 g/mol, XLogP of 3.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-chloropyrimidin-4-yl)amino]-2,3-dimethylbenzoic acid is sourced from PubChem (CID 174708673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).