C23H26N6 — CID 174709101
N-ethyl-5-phenyl-3-(1-piperidin-4-ylpyrazol-4-yl)indazol-1-amine (PubChem CID 174709101) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-ethyl-5-phenyl-3-(1-piperidin-4-ylpyrazol-4-yl)indazol-1-amine.
| Compound Name | N-ethyl-5-phenyl-3-(1-piperidin-4-ylpyrazol-4-yl)indazol-1-amine |
|---|---|
| PubChem CID | 174709101 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-ethyl-5-phenyl-3-(1-piperidin-4-ylpyrazol-4-yl)indazol-1-amine |
| SMILES | CCNn1nc(-c2cnn(C3CCNCC3)c2)c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C23H26N6/c1-2-25-29-22-9-8-18(17-6-4-3-5-7-17)14-21(22)23(27-29)19-15-26-28(16-19)20-10-12-24-13-11-20/h3-9,14-16,20,24-25H,2,10-13H2,1H3 |
| InChIKey | QGAMAIDVVNWIRT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |