C27H24N8 — CID 178082174
1-[4-anilino-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]indole-5-carbonitrile (PubChem CID 178082174) has the molecular formula C27H24N8 and a molecular weight of 460.55 g/mol. Its IUPAC name is 1-[4-anilino-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]indole-5-carbonitrile.
| Compound Name | 1-[4-anilino-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 178082174 |
| Molecular Formula | C27H24N8 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-[4-anilino-5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(ccn2-c2ncc(-c3cnn(C4CCNCC4)c3)c(Nc3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H24N8/c28-15-19-6-7-25-20(14-19)10-13-34(25)27-30-17-24(26(33-27)32-22-4-2-1-3-5-22)21-16-31-35(18-21)23-8-11-29-12-9-23/h1-7,10,13-14,16-18,23,29H,8-9,11-12H2,(H,30,32,33) |
| InChIKey | VZKUKIBRTHMFCK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |