C25H25N9 — CID 178082294
2-(3-aminoanilino)-4-[[5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 178082294) has the molecular formula C25H25N9 and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-(3-aminoanilino)-4-[[5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 2-(3-aminoanilino)-4-[[5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 178082294 |
| Molecular Formula | C25H25N9 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-(3-aminoanilino)-4-[[5-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(-c3cnn(C4CCNCC4)c3)cn2)cc1Nc1cccc(N)c1 |
| InChI | InChI=1S/C25H25N9/c26-12-17-4-5-22(11-24(17)32-21-3-1-2-20(27)10-21)33-25-29-13-18(14-30-25)19-15-31-34(16-19)23-6-8-28-9-7-23/h1-5,10-11,13-16,23,28,32H,6-9,27H2,(H,29,30,33) |
| InChIKey | HLRWSRQCTLKUBD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|