About fluoroform;2-(1-methoxyethyl)-1-methylimidazole
fluoroform;2-(1-methoxyethyl)-1-methylimidazole (PubChem CID 174709320) has the molecular formula C8H13F3N2O
and a molecular weight of 210.20 g/mol. Its IUPAC name is fluoroform;2-(1-methoxyethyl)-1-methylimidazole.
Molecular Properties
| Compound Name | fluoroform;2-(1-methoxyethyl)-1-methylimidazole |
| PubChem CID | 174709320 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | fluoroform;2-(1-methoxyethyl)-1-methylimidazole |
| SMILES | COC(C)c1nccn1C.FC(F)F |
| InChI | InChI=1S/C7H12N2O.CHF3/c1-6(10-3)7-8-4-5-9(7)2;2-1(3)4/h4-6H,1-3H3;1H |
| InChIKey | KWJYRZHOIQOHHK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze fluoroform;2-(1-methoxyethyl)-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;2-(1-methoxyethyl)-1-methylimidazole?
The IUPAC name of fluoroform;2-(1-methoxyethyl)-1-methylimidazole (CID 174709320) is fluoroform;2-(1-methoxyethyl)-1-methylimidazole.
What is the SMILES notation for fluoroform;2-(1-methoxyethyl)-1-methylimidazole?
The canonical SMILES for fluoroform;2-(1-methoxyethyl)-1-methylimidazole is COC(C)c1nccn1C.FC(F)F.
What is the InChIKey of fluoroform;2-(1-methoxyethyl)-1-methylimidazole?
The InChIKey is KWJYRZHOIQOHHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O.CHF3/c1-6(10-3)7-8-4-5-9(7)2;2-1(3)4/h4-6H,1-3H3;1H.
What are the key properties of fluoroform;2-(1-methoxyethyl)-1-methylimidazole?
fluoroform;2-(1-methoxyethyl)-1-methylimidazole has a molecular weight of 210.20 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;2-(1-methoxyethyl)-1-methylimidazole is sourced from PubChem (CID 174709320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).