C12H12F2N2 — CID 70942543
2-[1-(2,6-difluorophenyl)ethyl]-1-methylimidazole (PubChem CID 70942543) has the molecular formula C12H12F2N2 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)ethyl]-1-methylimidazole.
| Compound Name | 2-[1-(2,6-difluorophenyl)ethyl]-1-methylimidazole |
|---|---|
| PubChem CID | 70942543 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)ethyl]-1-methylimidazole |
| SMILES | CC(c1c(F)cccc1F)c1nccn1C |
| InChI | InChI=1S/C12H12F2N2/c1-8(12-15-6-7-16(12)2)11-9(13)4-3-5-10(11)14/h3-8H,1-2H3 |
| InChIKey | GFHJAMXFNVSIND-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |