About sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene
sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene (PubChem CID 174711074) has the molecular formula C26H45Na
and a molecular weight of 380.64 g/mol. Its IUPAC name is sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene |
| PubChem CID | 174711074 |
| Molecular Formula | C26H45Na |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene |
| SMILES | C=CCC1=[C-]CC=C1CCCCCCCCCCCCCCCCCC.[Na+] |
| InChI | InChI=1S/C26H45.Na/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-26-24-20-23-25(26)21-4-2;/h4,24H,2-3,5-22H2,1H3;/q-1;+1 |
| InChIKey | GEMALNQVVMLMCM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene?
The IUPAC name of sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene (CID 174711074) is sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene.
What is the SMILES notation for sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene?
The canonical SMILES for sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene is C=CCC1=[C-]CC=C1CCCCCCCCCCCCCCCCCC.[Na+].
What is the InChIKey of sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene?
The InChIKey is GEMALNQVVMLMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H45.Na/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-26-24-20-23-25(26)21-4-2;/h4,24H,2-3,5-22H2,1H3;/q-1;+1.
What are the key properties of sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene?
sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene has a molecular weight of 380.64 g/mol, XLogP of 6.28, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-octadecyl-3-prop-2-enylcyclopenta-1,3-diene is sourced from PubChem (CID 174711074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).