About diiodotitanium;1-phenyl-1H-indene
diiodotitanium;1-phenyl-1H-indene (PubChem CID 174711312) has the molecular formula C15H12I2Ti
and a molecular weight of 493.94 g/mol. Its IUPAC name is diiodotitanium;1-phenyl-1H-indene.
Molecular Properties
| Compound Name | diiodotitanium;1-phenyl-1H-indene |
| PubChem CID | 174711312 |
| Molecular Formula | C15H12I2Ti |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.85 |
| IUPAC Name | diiodotitanium;1-phenyl-1H-indene |
| SMILES | C1=CC(c2ccccc2)c2ccccc21.I[Ti]I |
| InChI | InChI=1S/C15H12.2HI.Ti/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h1-11,15H;2*1H;/q;;;+2/p-2 |
| InChIKey | SWKXJZISIWWZGG-UHFFFAOYSA-L |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diiodotitanium;1-phenyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodotitanium;1-phenyl-1H-indene?
The IUPAC name of diiodotitanium;1-phenyl-1H-indene (CID 174711312) is diiodotitanium;1-phenyl-1H-indene.
What is the SMILES notation for diiodotitanium;1-phenyl-1H-indene?
The canonical SMILES for diiodotitanium;1-phenyl-1H-indene is C1=CC(c2ccccc2)c2ccccc21.I[Ti]I.
What is the InChIKey of diiodotitanium;1-phenyl-1H-indene?
The InChIKey is SWKXJZISIWWZGG-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H12.2HI.Ti/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)15;;;/h1-11,15H;2*1H;/q;;;+2/p-2.
What are the key properties of diiodotitanium;1-phenyl-1H-indene?
diiodotitanium;1-phenyl-1H-indene has a molecular weight of 493.94 g/mol, XLogP of 5.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diiodotitanium;1-phenyl-1H-indene is sourced from PubChem (CID 174711312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).